About methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate
methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate (PubChem CID 75523823) has the molecular formula C13H18N2O3S
and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate |
| PubChem CID | 75523823 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate |
| SMILES | CCC(NC(=O)C1(C(=O)OC)CC1)c1ncc(C)s1 |
| InChI | InChI=1S/C13H18N2O3S/c1-4-9(10-14-7-8(2)19-10)15-11(16)13(5-6-13)12(17)18-3/h7,9H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | BLCIJVUJCDKCCF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate?
The IUPAC name of methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate (CID 75523823) is methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate is CCC(NC(=O)C1(C(=O)OC)CC1)c1ncc(C)s1.
What is the InChIKey of methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate?
The InChIKey is BLCIJVUJCDKCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3S/c1-4-9(10-14-7-8(2)19-10)15-11(16)13(5-6-13)12(17)18-3/h7,9H,4-6H2,1-3H3,(H,15,16).
What are the key properties of methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate?
methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate has a molecular weight of 282.36 g/mol, XLogP of 1.97, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[1-(5-methyl-1,3-thiazol-2-yl)propylcarbamoyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 75523823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).