About 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline
3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline (PubChem CID 75523841) has the molecular formula C15H12N4
and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline.
Molecular Properties
| Compound Name | 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline |
| PubChem CID | 75523841 |
| Molecular Formula | C15H12N4 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline |
| SMILES | C#Cc1cccc(NCc2cnc3cnccn23)c1 |
| InChI | InChI=1S/C15H12N4/c1-2-12-4-3-5-13(8-12)17-9-14-10-18-15-11-16-6-7-19(14)15/h1,3-8,10-11,17H,9H2 |
| InChIKey | AOVQBSNQONUVLB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline?
The IUPAC name of 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline (CID 75523841) is 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline.
What is the SMILES notation for 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline?
The canonical SMILES for 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline is C#Cc1cccc(NCc2cnc3cnccn23)c1.
What is the InChIKey of 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline?
The InChIKey is AOVQBSNQONUVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4/c1-2-12-4-3-5-13(8-12)17-9-14-10-18-15-11-16-6-7-19(14)15/h1,3-8,10-11,17H,9H2.
What are the key properties of 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline?
3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline has a molecular weight of 248.29 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-N-(imidazo[1,2-a]pyrazin-3-ylmethyl)aniline is sourced from PubChem (CID 75523841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).