C18H20ClN5O — CID 75524387
3-[[4-[(2-chloroquinolin-4-yl)methyl]piperazin-1-yl]methyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 75524387) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is 3-[[4-[(2-chloroquinolin-4-yl)methyl]piperazin-1-yl]methyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[[4-[(2-chloroquinolin-4-yl)methyl]piperazin-1-yl]methyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 75524387 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-[[4-[(2-chloroquinolin-4-yl)methyl]piperazin-1-yl]methyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | Cc1nc(CN2CCN(Cc3cc(Cl)nc4ccccc34)CC2)no1 |
| InChI | InChI=1S/C18H20ClN5O/c1-13-20-18(22-25-13)12-24-8-6-23(7-9-24)11-14-10-17(19)21-16-5-3-2-4-15(14)16/h2-5,10H,6-9,11-12H2,1H3 |
| InChIKey | PFOIBRKOOPBCHY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|