C18H23N3O3 — CID 75524613
2-[5-(7-oxooctyl)-1,2,4-oxadiazol-3-yl]-N-phenylacetamide (PubChem CID 75524613) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-[5-(7-oxooctyl)-1,2,4-oxadiazol-3-yl]-N-phenylacetamide.
| Compound Name | 2-[5-(7-oxooctyl)-1,2,4-oxadiazol-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 75524613 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-[5-(7-oxooctyl)-1,2,4-oxadiazol-3-yl]-N-phenylacetamide |
| SMILES | CC(=O)CCCCCCc1nc(CC(=O)Nc2ccccc2)no1 |
| InChI | InChI=1S/C18H23N3O3/c1-14(22)9-5-2-3-8-12-18-20-16(21-24-18)13-17(23)19-15-10-6-4-7-11-15/h4,6-7,10-11H,2-3,5,8-9,12-13H2,1H3,(H,19,23) |
| InChIKey | JSPAZLNNUWYOHB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|