About ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate
ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate (PubChem CID 75524841) has the molecular formula C16H21N3O2S
and a molecular weight of 319.43 g/mol. Its IUPAC name is ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate |
| PubChem CID | 75524841 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(C)c2cnc3ccsc3c2)CC1 |
| InChI | InChI=1S/C16H21N3O2S/c1-3-21-16(20)19-7-5-18(6-8-19)12(2)13-10-15-14(17-11-13)4-9-22-15/h4,9-12H,3,5-8H2,1-2H3 |
| InChIKey | WOUMOGUWHZXVMM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate?
The IUPAC name of ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate (CID 75524841) is ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate is CCOC(=O)N1CCN(C(C)c2cnc3ccsc3c2)CC1.
What is the InChIKey of ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate?
The InChIKey is WOUMOGUWHZXVMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2S/c1-3-21-16(20)19-7-5-18(6-8-19)12(2)13-10-15-14(17-11-13)4-9-22-15/h4,9-12H,3,5-8H2,1-2H3.
What are the key properties of ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate?
ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate has a molecular weight of 319.43 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(1-thieno[3,2-b]pyridin-6-ylethyl)piperazine-1-carboxylate is sourced from PubChem (CID 75524841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).