About 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one
7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one (PubChem CID 75524995) has the molecular formula C7H5IN2O
and a molecular weight of 260.03 g/mol. Its IUPAC name is 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one.
Molecular Properties
| Compound Name | 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one |
| PubChem CID | 75524995 |
| Molecular Formula | C7H5IN2O |
| Molecular Weight | 260.03 g/mol |
| Exact Mass | 259.94 |
| IUPAC Name | 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one |
| SMILES | O=c1[nH]ccn2cc(I)cc12 |
| InChI | InChI=1S/C7H5IN2O/c8-5-3-6-7(11)9-1-2-10(6)4-5/h1-4H,(H,9,11) |
| InChIKey | IIEHJIOEUMCSGG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.03 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one?
The IUPAC name of 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one (CID 75524995) is 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one.
What is the SMILES notation for 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one?
The canonical SMILES for 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one is O=c1[nH]ccn2cc(I)cc12.
What is the InChIKey of 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one?
The InChIKey is IIEHJIOEUMCSGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IN2O/c8-5-3-6-7(11)9-1-2-10(6)4-5/h1-4H,(H,9,11).
What are the key properties of 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one?
7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one has a molecular weight of 260.03 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-2H-pyrrolo[1,2-a]pyrazin-1-one is sourced from PubChem (CID 75524995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).