About N-methylbut-3-en-2-amine;hydrochloride
N-methylbut-3-en-2-amine;hydrochloride (PubChem CID 75525004) has the molecular formula C5H12ClN
and a molecular weight of 121.61 g/mol. Its IUPAC name is N-methylbut-3-en-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-methylbut-3-en-2-amine;hydrochloride |
| PubChem CID | 75525004 |
| Molecular Formula | C5H12ClN |
| Molecular Weight | 121.61 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | N-methylbut-3-en-2-amine;hydrochloride |
| SMILES | C=CC(C)NC.Cl |
| InChI | InChI=1S/C5H11N.ClH/c1-4-5(2)6-3;/h4-6H,1H2,2-3H3;1H |
| InChIKey | VPOOODAACUUBNA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.61 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methylbut-3-en-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylbut-3-en-2-amine;hydrochloride?
The IUPAC name of N-methylbut-3-en-2-amine;hydrochloride (CID 75525004) is N-methylbut-3-en-2-amine;hydrochloride.
What is the SMILES notation for N-methylbut-3-en-2-amine;hydrochloride?
The canonical SMILES for N-methylbut-3-en-2-amine;hydrochloride is C=CC(C)NC.Cl.
What is the InChIKey of N-methylbut-3-en-2-amine;hydrochloride?
The InChIKey is VPOOODAACUUBNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.ClH/c1-4-5(2)6-3;/h4-6H,1H2,2-3H3;1H.
What are the key properties of N-methylbut-3-en-2-amine;hydrochloride?
N-methylbut-3-en-2-amine;hydrochloride has a molecular weight of 121.61 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylbut-3-en-2-amine;hydrochloride is sourced from PubChem (CID 75525004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).