About 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol
2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol (PubChem CID 75525275) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol |
| PubChem CID | 75525275 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol |
| SMILES | CC(CO)NC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C10H21NO2/c1-7(6-12)11-10-4-8(2)13-9(3)5-10/h7-12H,4-6H2,1-3H3 |
| InChIKey | VKCKFUNRTDLFLI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol?
The IUPAC name of 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol (CID 75525275) is 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol.
What is the SMILES notation for 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol?
The canonical SMILES for 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol is CC(CO)NC1CC(C)OC(C)C1.
What is the InChIKey of 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol?
The InChIKey is VKCKFUNRTDLFLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-7(6-12)11-10-4-8(2)13-9(3)5-10/h7-12H,4-6H2,1-3H3.
What are the key properties of 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol?
2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol has a molecular weight of 187.28 g/mol, XLogP of 0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dimethyloxan-4-yl)amino]propan-1-ol is sourced from PubChem (CID 75525275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).