About 4,4-diethylazepane
4,4-diethylazepane (PubChem CID 75525697) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is 4,4-diethylazepane.
Molecular Properties
| Compound Name | 4,4-diethylazepane |
| PubChem CID | 75525697 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 4,4-diethylazepane |
| SMILES | CCC1(CC)CCCNCC1 |
| InChI | InChI=1S/C10H21N/c1-3-10(4-2)6-5-8-11-9-7-10/h11H,3-9H2,1-2H3 |
| InChIKey | HXPJBAVMNKVDLR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-diethylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diethylazepane?
The IUPAC name of 4,4-diethylazepane (CID 75525697) is 4,4-diethylazepane.
What is the SMILES notation for 4,4-diethylazepane?
The canonical SMILES for 4,4-diethylazepane is CCC1(CC)CCCNCC1.
What is the InChIKey of 4,4-diethylazepane?
The InChIKey is HXPJBAVMNKVDLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N/c1-3-10(4-2)6-5-8-11-9-7-10/h11H,3-9H2,1-2H3.
What are the key properties of 4,4-diethylazepane?
4,4-diethylazepane has a molecular weight of 155.28 g/mol, XLogP of 2.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diethylazepane is sourced from PubChem (CID 75525697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).