About 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride
2-morpholin-4-ylethanesulfonyl chloride;hydrochloride (PubChem CID 75525709) has the molecular formula C6H13Cl2NO3S
and a molecular weight of 250.15 g/mol. Its IUPAC name is 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride |
| PubChem CID | 75525709 |
| Molecular Formula | C6H13Cl2NO3S |
| Molecular Weight | 250.15 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride |
| SMILES | Cl.O=S(=O)(Cl)CCN1CCOCC1 |
| InChI | InChI=1S/C6H12ClNO3S.ClH/c7-12(9,10)6-3-8-1-4-11-5-2-8;/h1-6H2;1H |
| InChIKey | RSKSQHXTOZQESA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.15 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride?
The IUPAC name of 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride (CID 75525709) is 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride.
What is the SMILES notation for 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride?
The canonical SMILES for 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride is Cl.O=S(=O)(Cl)CCN1CCOCC1.
What is the InChIKey of 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride?
The InChIKey is RSKSQHXTOZQESA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO3S.ClH/c7-12(9,10)6-3-8-1-4-11-5-2-8;/h1-6H2;1H.
What are the key properties of 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride?
2-morpholin-4-ylethanesulfonyl chloride;hydrochloride has a molecular weight of 250.15 g/mol, XLogP of 0.31, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethanesulfonyl chloride;hydrochloride is sourced from PubChem (CID 75525709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).