About 2-(2,2-difluoroethoxy)ethanamine;hydrochloride
2-(2,2-difluoroethoxy)ethanamine;hydrochloride (PubChem CID 75525737) has the molecular formula C4H10ClF2NO
and a molecular weight of 161.58 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethoxy)ethanamine;hydrochloride |
| PubChem CID | 75525737 |
| Molecular Formula | C4H10ClF2NO |
| Molecular Weight | 161.58 g/mol |
| Exact Mass | 161.04 |
| IUPAC Name | 2-(2,2-difluoroethoxy)ethanamine;hydrochloride |
| SMILES | Cl.NCCOCC(F)F |
| InChI | InChI=1S/C4H9F2NO.ClH/c5-4(6)3-8-2-1-7;/h4H,1-3,7H2;1H |
| InChIKey | ONSIEGYAELPMFN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.58 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-difluoroethoxy)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethoxy)ethanamine;hydrochloride?
The IUPAC name of 2-(2,2-difluoroethoxy)ethanamine;hydrochloride (CID 75525737) is 2-(2,2-difluoroethoxy)ethanamine;hydrochloride.
What is the SMILES notation for 2-(2,2-difluoroethoxy)ethanamine;hydrochloride?
The canonical SMILES for 2-(2,2-difluoroethoxy)ethanamine;hydrochloride is Cl.NCCOCC(F)F.
What is the InChIKey of 2-(2,2-difluoroethoxy)ethanamine;hydrochloride?
The InChIKey is ONSIEGYAELPMFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F2NO.ClH/c5-4(6)3-8-2-1-7;/h4H,1-3,7H2;1H.
What are the key properties of 2-(2,2-difluoroethoxy)ethanamine;hydrochloride?
2-(2,2-difluoroethoxy)ethanamine;hydrochloride has a molecular weight of 161.58 g/mol, XLogP of 0.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethoxy)ethanamine;hydrochloride is sourced from PubChem (CID 75525737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).