About (1-methylpyrazol-3-yl)hydrazine;trihydrochloride
(1-methylpyrazol-3-yl)hydrazine;trihydrochloride (PubChem CID 75525830) has the molecular formula C4H11Cl3N4
and a molecular weight of 221.52 g/mol. Its IUPAC name is (1-methylpyrazol-3-yl)hydrazine;trihydrochloride.
Molecular Properties
| Compound Name | (1-methylpyrazol-3-yl)hydrazine;trihydrochloride |
| PubChem CID | 75525830 |
| Molecular Formula | C4H11Cl3N4 |
| Molecular Weight | 221.52 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | (1-methylpyrazol-3-yl)hydrazine;trihydrochloride |
| SMILES | Cl.Cl.Cl.Cn1ccc(NN)n1 |
| InChI | InChI=1S/C4H8N4.3ClH/c1-8-3-2-4(6-5)7-8;;;/h2-3H,5H2,1H3,(H,6,7);3*1H |
| InChIKey | VJSFRERLGQGLEB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpyrazol-3-yl)hydrazine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrazol-3-yl)hydrazine;trihydrochloride?
The IUPAC name of (1-methylpyrazol-3-yl)hydrazine;trihydrochloride (CID 75525830) is (1-methylpyrazol-3-yl)hydrazine;trihydrochloride.
What is the SMILES notation for (1-methylpyrazol-3-yl)hydrazine;trihydrochloride?
The canonical SMILES for (1-methylpyrazol-3-yl)hydrazine;trihydrochloride is Cl.Cl.Cl.Cn1ccc(NN)n1.
What is the InChIKey of (1-methylpyrazol-3-yl)hydrazine;trihydrochloride?
The InChIKey is VJSFRERLGQGLEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4.3ClH/c1-8-3-2-4(6-5)7-8;;;/h2-3H,5H2,1H3,(H,6,7);3*1H.
What are the key properties of (1-methylpyrazol-3-yl)hydrazine;trihydrochloride?
(1-methylpyrazol-3-yl)hydrazine;trihydrochloride has a molecular weight of 221.52 g/mol, XLogP of 0.97, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrazol-3-yl)hydrazine;trihydrochloride is sourced from PubChem (CID 75525830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).