C14H20N6O4 — CID 75526173
2-(2,5-dioxoimidazolidin-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]acetamide (PubChem CID 75526173) has the molecular formula C14H20N6O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 75526173 |
| Molecular Formula | C14H20N6O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-4-yl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]acetamide |
| SMILES | O=C(CC1NC(=O)NC1=O)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C14H20N6O4/c21-11(8-9-12(22)17-13(23)16-9)15-5-3-7-20-14(24)19-6-2-1-4-10(19)18-20/h9H,1-8H2,(H,15,21)(H2,16,17,22,23) |
| InChIKey | IKODIGGPCYPTEJ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|