About 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate
3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate (PubChem CID 75526290) has the molecular formula C11H13F3N2O4
and a molecular weight of 294.23 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate.
Molecular Properties
| Compound Name | 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate |
| PubChem CID | 75526290 |
| Molecular Formula | C11H13F3N2O4 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate |
| SMILES | Cn1nc(C(=O)OCCCOCC(F)(F)F)ccc1=O |
| InChI | InChI=1S/C11H13F3N2O4/c1-16-9(17)4-3-8(15-16)10(18)20-6-2-5-19-7-11(12,13)14/h3-4H,2,5-7H2,1H3 |
| InChIKey | QWGWVGWBAKOHAU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate?
The IUPAC name of 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate (CID 75526290) is 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate.
What is the SMILES notation for 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate?
The canonical SMILES for 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate is Cn1nc(C(=O)OCCCOCC(F)(F)F)ccc1=O.
What is the InChIKey of 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate?
The InChIKey is QWGWVGWBAKOHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3N2O4/c1-16-9(17)4-3-8(15-16)10(18)20-6-2-5-19-7-11(12,13)14/h3-4H,2,5-7H2,1H3.
What are the key properties of 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate?
3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate has a molecular weight of 294.23 g/mol, XLogP of 0.91, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2,2-trifluoroethoxy)propyl 1-methyl-6-oxopyridazine-3-carboxylate is sourced from PubChem (CID 75526290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).