C16H14F2O4S — CID 75526403
[4-(cyclopropylmethoxy)phenyl] 2,6-difluorobenzenesulfonate (PubChem CID 75526403) has the molecular formula C16H14F2O4S and a molecular weight of 340.35 g/mol. Its IUPAC name is [4-(cyclopropylmethoxy)phenyl] 2,6-difluorobenzenesulfonate.
| Compound Name | [4-(cyclopropylmethoxy)phenyl] 2,6-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 75526403 |
| Molecular Formula | C16H14F2O4S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | [4-(cyclopropylmethoxy)phenyl] 2,6-difluorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(OCC2CC2)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C16H14F2O4S/c17-14-2-1-3-15(18)16(14)23(19,20)22-13-8-6-12(7-9-13)21-10-11-4-5-11/h1-3,6-9,11H,4-5,10H2 |
| InChIKey | XZILHNIPOZJDRN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|