About ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride
ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride (PubChem CID 75526665) has the molecular formula C9H17ClN2O3
and a molecular weight of 236.70 g/mol. Its IUPAC name is ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride |
| PubChem CID | 75526665 |
| Molecular Formula | C9H17ClN2O3 |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride |
| SMILES | CCOC(=O)C(=O)N1CCCC(N)C1.Cl |
| InChI | InChI=1S/C9H16N2O3.ClH/c1-2-14-9(13)8(12)11-5-3-4-7(10)6-11;/h7H,2-6,10H2,1H3;1H |
| InChIKey | PDOXREJPEGNNCP-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride?
The IUPAC name of ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride (CID 75526665) is ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride.
What is the SMILES notation for ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride?
The canonical SMILES for ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride is CCOC(=O)C(=O)N1CCCC(N)C1.Cl.
What is the InChIKey of ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride?
The InChIKey is PDOXREJPEGNNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3.ClH/c1-2-14-9(13)8(12)11-5-3-4-7(10)6-11;/h7H,2-6,10H2,1H3;1H.
What are the key properties of ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride?
ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride has a molecular weight of 236.70 g/mol, XLogP of -0.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(3-aminopiperidin-1-yl)-2-oxoacetate;hydrochloride is sourced from PubChem (CID 75526665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).