C15H17ClN4O2 — CID 75526901
N-[(2-chlorophenyl)methyl]-2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetamide (PubChem CID 75526901) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetamide |
|---|---|
| PubChem CID | 75526901 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)acetamide |
| SMILES | O=C(Cn1nc2n(c1=O)CCCC2)NCc1ccccc1Cl |
| InChI | InChI=1S/C15H17ClN4O2/c16-12-6-2-1-5-11(12)9-17-14(21)10-20-15(22)19-8-4-3-7-13(19)18-20/h1-2,5-6H,3-4,7-10H2,(H,17,21) |
| InChIKey | PMTZYGZMUCYWAU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |