About 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one
3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one (PubChem CID 7552698) has the molecular formula C17H21NOS
and a molecular weight of 287.43 g/mol. Its IUPAC name is 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one.
Molecular Properties
| Compound Name | 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one |
| PubChem CID | 7552698 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one |
| SMILES | Cc1ccc2scc(N3[C@H](C)CCC[C@H]3C)c(=O)c2c1 |
| InChI | InChI=1S/C17H21NOS/c1-11-7-8-16-14(9-11)17(19)15(10-20-16)18-12(2)5-4-6-13(18)3/h7-10,12-13H,4-6H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | CIFKTBHDTOCTOW-CHWSQXEVSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one?
The IUPAC name of 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one (CID 7552698) is 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one.
What is the SMILES notation for 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one?
The canonical SMILES for 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one is Cc1ccc2scc(N3[C@H](C)CCC[C@H]3C)c(=O)c2c1.
What is the InChIKey of 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one?
The InChIKey is CIFKTBHDTOCTOW-CHWSQXEVSA-N. The full InChI is InChI=1S/C17H21NOS/c1-11-7-8-16-14(9-11)17(19)15(10-20-16)18-12(2)5-4-6-13(18)3/h7-10,12-13H,4-6H2,1-3H3/t12-,13-/m1/s1.
What are the key properties of 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one?
3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one has a molecular weight of 287.43 g/mol, XLogP of 4.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-6-methylthiochromen-4-one is sourced from PubChem (CID 7552698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).