C20H25N5O3 — CID 75528680
N-cyclopentyl-2-[7-[(3-methylphenyl)methyl]-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl]acetamide (PubChem CID 75528680) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-cyclopentyl-2-[7-[(3-methylphenyl)methyl]-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl]acetamide.
| Compound Name | N-cyclopentyl-2-[7-[(3-methylphenyl)methyl]-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl]acetamide |
|---|---|
| PubChem CID | 75528680 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-cyclopentyl-2-[7-[(3-methylphenyl)methyl]-3,8-dioxo-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazin-2-yl]acetamide |
| SMILES | Cc1cccc(CN2CCn3c(nn(CC(=O)NC4CCCC4)c3=O)C2=O)c1 |
| InChI | InChI=1S/C20H25N5O3/c1-14-5-4-6-15(11-14)12-23-9-10-24-18(19(23)27)22-25(20(24)28)13-17(26)21-16-7-2-3-8-16/h4-6,11,16H,2-3,7-10,12-13H2,1H3,(H,21,26) |
| InChIKey | PXKGXDKKKMLKRV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |