C10H11NO4 — CID 75528858
2-methylidene-3-oxo-4a,7,8,8a-tetrahydro-4H-1,4-benzoxazine-7-carboxylic acid (PubChem CID 75528858) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 2-methylidene-3-oxo-4a,7,8,8a-tetrahydro-4H-1,4-benzoxazine-7-carboxylic acid.
| Compound Name | 2-methylidene-3-oxo-4a,7,8,8a-tetrahydro-4H-1,4-benzoxazine-7-carboxylic acid |
|---|---|
| PubChem CID | 75528858 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-methylidene-3-oxo-4a,7,8,8a-tetrahydro-4H-1,4-benzoxazine-7-carboxylic acid |
| SMILES | C=C1OC2CC(C(=O)O)C=CC2NC1=O |
| InChI | InChI=1S/C10H11NO4/c1-5-9(12)11-7-3-2-6(10(13)14)4-8(7)15-5/h2-3,6-8H,1,4H2,(H,11,12)(H,13,14) |
| InChIKey | WNMPQEGJLZLCFC-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|