C24H43NO3 — CID 75528920
(2E,4E,14E)-13-hydroperoxy-N-(2-methylpropyl)icosa-2,4,14-trienamide (PubChem CID 75528920) has the molecular formula C24H43NO3 and a molecular weight of 393.61 g/mol. Its IUPAC name is (2E,4E,14E)-13-hydroperoxy-N-(2-methylpropyl)icosa-2,4,14-trienamide.
| Compound Name | (2E,4E,14E)-13-hydroperoxy-N-(2-methylpropyl)icosa-2,4,14-trienamide |
|---|---|
| PubChem CID | 75528920 |
| Molecular Formula | C24H43NO3 |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 393.32 |
| IUPAC Name | (2E,4E,14E)-13-hydroperoxy-N-(2-methylpropyl)icosa-2,4,14-trienamide |
| SMILES | CCCCC/C=C/C(CCCCCCC/C=C/C=C/C(=O)NCC(C)C)OO |
| InChI | InChI=1S/C24H43NO3/c1-4-5-6-12-15-18-23(28-27)19-16-13-10-8-7-9-11-14-17-20-24(26)25-21-22(2)3/h11,14-15,17-18,20,22-23,27H,4-10,12-13,16,19,21H2,1-3H3,(H,25,26)/b14-11+,18-15+,20-17+ |
| InChIKey | SWLNXMJZQXZBCB-QQYDYBFASA-N |
| XLogP | 6.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|