C15H26O3 — CID 75528935
[5,8a-bis(hydroxymethyl)-2,5-dimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol (PubChem CID 75528935) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is [5,8a-bis(hydroxymethyl)-2,5-dimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol.
| Compound Name | [5,8a-bis(hydroxymethyl)-2,5-dimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 75528935 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | [5,8a-bis(hydroxymethyl)-2,5-dimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]methanol |
| SMILES | CC1=CCC2C(C)(CO)CCCC2(CO)C1CO |
| InChI | InChI=1S/C15H26O3/c1-11-4-5-13-14(2,9-17)6-3-7-15(13,10-18)12(11)8-16/h4,12-13,16-18H,3,5-10H2,1-2H3 |
| InChIKey | FUVVLIGUEPFKDK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|