C18H23FN2O3 — CID 75529051
(6S)-14-fluoro-9-hexanoyl-4-oxa-2,9-diazatricyclo[9.4.0.02,6]pentadeca-1(11),12,14-trien-3-one (PubChem CID 75529051) has the molecular formula C18H23FN2O3 and a molecular weight of 334.39 g/mol. Its IUPAC name is (6S)-14-fluoro-9-hexanoyl-4-oxa-2,9-diazatricyclo[9.4.0.02,6]pentadeca-1(11),12,14-trien-3-one.
| Compound Name | (6S)-14-fluoro-9-hexanoyl-4-oxa-2,9-diazatricyclo[9.4.0.02,6]pentadeca-1(11),12,14-trien-3-one |
|---|---|
| PubChem CID | 75529051 |
| Molecular Formula | C18H23FN2O3 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (6S)-14-fluoro-9-hexanoyl-4-oxa-2,9-diazatricyclo[9.4.0.02,6]pentadeca-1(11),12,14-trien-3-one |
| SMILES | CCCCCC(=O)N1CC[C@H]2COC(=O)N2c2cc(F)ccc2C1 |
| InChI | InChI=1S/C18H23FN2O3/c1-2-3-4-5-17(22)20-9-8-15-12-24-18(23)21(15)16-10-14(19)7-6-13(16)11-20/h6-7,10,15H,2-5,8-9,11-12H2,1H3/t15-/m0/s1 |
| InChIKey | OXCWJQRZBBIRIH-HNNXBMFYSA-N |
| XLogP | 3.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|