C18H30N4O — CID 75529260
[(2S)-1,9-dimethyl-5-(1-methylpiperidin-4-yl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol (PubChem CID 75529260) has the molecular formula C18H30N4O and a molecular weight of 318.46 g/mol. Its IUPAC name is [(2S)-1,9-dimethyl-5-(1-methylpiperidin-4-yl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol.
| Compound Name | [(2S)-1,9-dimethyl-5-(1-methylpiperidin-4-yl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol |
|---|---|
| PubChem CID | 75529260 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | [(2S)-1,9-dimethyl-5-(1-methylpiperidin-4-yl)-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol |
| SMILES | Cc1ccc2c(n1)N(C)[C@H](CO)CCN(C1CCN(C)CC1)C2 |
| InChI | InChI=1S/C18H30N4O/c1-14-4-5-15-12-22(16-6-9-20(2)10-7-16)11-8-17(13-23)21(3)18(15)19-14/h4-5,16-17,23H,6-13H2,1-3H3/t17-/m0/s1 |
| InChIKey | JVAOYDXLUBSQCL-KRWDZBQOSA-N |
| XLogP | 1.49 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |