C20H25N3O3 — CID 75529261
[(2S)-5-(1,3-benzodioxol-5-ylmethyl)-1,9-dimethyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol (PubChem CID 75529261) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [(2S)-5-(1,3-benzodioxol-5-ylmethyl)-1,9-dimethyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol.
| Compound Name | [(2S)-5-(1,3-benzodioxol-5-ylmethyl)-1,9-dimethyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol |
|---|---|
| PubChem CID | 75529261 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [(2S)-5-(1,3-benzodioxol-5-ylmethyl)-1,9-dimethyl-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol |
| SMILES | Cc1ccc2c(n1)N(C)[C@H](CO)CCN(Cc1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C20H25N3O3/c1-14-3-5-16-11-23(8-7-17(12-24)22(2)20(16)21-14)10-15-4-6-18-19(9-15)26-13-25-18/h3-6,9,17,24H,7-8,10-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | GMFITVQDAPQHPH-KRWDZBQOSA-N |
| XLogP | 2.32 |
| TPSA | 58.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |