C20H24F3N3O — CID 75529267
[(2S)-1,9-dimethyl-5-[[4-(trifluoromethyl)phenyl]methyl]-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol (PubChem CID 75529267) has the molecular formula C20H24F3N3O and a molecular weight of 379.43 g/mol. Its IUPAC name is [(2S)-1,9-dimethyl-5-[[4-(trifluoromethyl)phenyl]methyl]-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol.
| Compound Name | [(2S)-1,9-dimethyl-5-[[4-(trifluoromethyl)phenyl]methyl]-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol |
|---|---|
| PubChem CID | 75529267 |
| Molecular Formula | C20H24F3N3O |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | [(2S)-1,9-dimethyl-5-[[4-(trifluoromethyl)phenyl]methyl]-2,3,4,6-tetrahydropyrido[2,3-b][1,5]diazocin-2-yl]methanol |
| SMILES | Cc1ccc2c(n1)N(C)[C@H](CO)CCN(Cc1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C20H24F3N3O/c1-14-3-6-16-12-26(10-9-18(13-27)25(2)19(16)24-14)11-15-4-7-17(8-5-15)20(21,22)23/h3-8,18,27H,9-13H2,1-2H3/t18-/m0/s1 |
| InChIKey | YYJMZHUGOXHEKG-SFHVURJKSA-N |
| XLogP | 3.61 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |