C12H19N3O — CID 75529274
[(2S)-1,9-dimethyl-3,4,5,6-tetrahydro-2H-pyrido[2,3-b][1,5]diazocin-2-yl]methanol (PubChem CID 75529274) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is [(2S)-1,9-dimethyl-3,4,5,6-tetrahydro-2H-pyrido[2,3-b][1,5]diazocin-2-yl]methanol.
| Compound Name | [(2S)-1,9-dimethyl-3,4,5,6-tetrahydro-2H-pyrido[2,3-b][1,5]diazocin-2-yl]methanol |
|---|---|
| PubChem CID | 75529274 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | [(2S)-1,9-dimethyl-3,4,5,6-tetrahydro-2H-pyrido[2,3-b][1,5]diazocin-2-yl]methanol |
| SMILES | Cc1ccc2c(n1)N(C)[C@H](CO)CCNC2 |
| InChI | InChI=1S/C12H19N3O/c1-9-3-4-10-7-13-6-5-11(8-16)15(2)12(10)14-9/h3-4,11,13,16H,5-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | SQWOYWAMWYZLDY-NSHDSACASA-N |
| XLogP | 0.68 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |