C19H24N6O3 — CID 75529400
(1R,2S,3R,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-5-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentane-1,2-diol (PubChem CID 75529400) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-5-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-5-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 75529400 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (1R,2S,3R,5R)-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-5-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentane-1,2-diol |
| SMILES | Cc1noc(C)c1CN[C@@H]1C[C@H](Cn2cc(-c3cccnc3)nn2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H24N6O3/c1-11-15(12(2)28-23-11)8-21-16-6-14(18(26)19(16)27)9-25-10-17(22-24-25)13-4-3-5-20-7-13/h3-5,7,10,14,16,18-19,21,26-27H,6,8-9H2,1-2H3/t14-,16-,18-,19+/m1/s1 |
| InChIKey | HKWIGMSQFLRXIY-OPNNQBFTSA-N |
| XLogP | 0.85 |
| TPSA | 122.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |