C17H24N6O3 — CID 75529461
1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3-propylurea (PubChem CID 75529461) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is 1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3-propylurea.
| Compound Name | 1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3-propylurea |
|---|---|
| PubChem CID | 75529461 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1-[(1R,2S,3R,4R)-2,3-dihydroxy-4-[(4-pyridin-3-yltriazol-1-yl)methyl]cyclopentyl]-3-propylurea |
| SMILES | CCCNC(=O)N[C@@H]1C[C@H](Cn2cc(-c3cccnc3)nn2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H24N6O3/c1-2-5-19-17(26)20-13-7-12(15(24)16(13)25)9-23-10-14(21-22-23)11-4-3-6-18-8-11/h3-4,6,8,10,12-13,15-16,24-25H,2,5,7,9H2,1H3,(H2,19,20,26)/t12-,13-,15-,16+/m1/s1 |
| InChIKey | QGKVHYGOALTJQK-XOUADPBQSA-N |
| XLogP | 0.16 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |