C22H28N6O4 — CID 75529590
N-[(1R,2S,3R,4R)-4-[[4-[(dimethylamino)methyl]triazol-1-yl]methyl]-2,3-dihydroxycyclopentyl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide (PubChem CID 75529590) has the molecular formula C22H28N6O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[(1R,2S,3R,4R)-4-[[4-[(dimethylamino)methyl]triazol-1-yl]methyl]-2,3-dihydroxycyclopentyl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(1R,2S,3R,4R)-4-[[4-[(dimethylamino)methyl]triazol-1-yl]methyl]-2,3-dihydroxycyclopentyl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 75529590 |
| Molecular Formula | C22H28N6O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | N-[(1R,2S,3R,4R)-4-[[4-[(dimethylamino)methyl]triazol-1-yl]methyl]-2,3-dihydroxycyclopentyl]-5-methyl-3-phenyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1onc(-c2ccccc2)c1C(=O)N[C@@H]1C[C@H](Cn2cc(CN(C)C)nn2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H28N6O4/c1-13-18(19(25-32-13)14-7-5-4-6-8-14)22(31)23-17-9-15(20(29)21(17)30)10-28-12-16(24-26-28)11-27(2)3/h4-8,12,15,17,20-21,29-30H,9-11H2,1-3H3,(H,23,31)/t15-,17-,20-,21+/m1/s1 |
| InChIKey | VZBBYOGVQJJFOV-JKMAKKBCSA-N |
| XLogP | 0.84 |
| TPSA | 129.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |