About 2-azatricyclo[3.3.1.13,7]decane;hydrochloride
2-azatricyclo[3.3.1.13,7]decane;hydrochloride (PubChem CID 75529762) has the molecular formula C9H16ClN
and a molecular weight of 173.69 g/mol. Its IUPAC name is 2-azatricyclo[3.3.1.13,7]decane;hydrochloride.
Molecular Properties
| Compound Name | 2-azatricyclo[3.3.1.13,7]decane;hydrochloride |
| PubChem CID | 75529762 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2-azatricyclo[3.3.1.13,7]decane;hydrochloride |
| SMILES | C1C2CC3CC1CC(C2)N3.Cl |
| InChI | InChI=1S/C9H15N.ClH/c1-6-2-8-4-7(1)5-9(3-6)10-8;/h6-10H,1-5H2;1H |
| InChIKey | ZWIULPRXCDAQFM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-azatricyclo[3.3.1.13,7]decane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azatricyclo[3.3.1.13,7]decane;hydrochloride?
The IUPAC name of 2-azatricyclo[3.3.1.13,7]decane;hydrochloride (CID 75529762) is 2-azatricyclo[3.3.1.13,7]decane;hydrochloride.
What is the SMILES notation for 2-azatricyclo[3.3.1.13,7]decane;hydrochloride?
The canonical SMILES for 2-azatricyclo[3.3.1.13,7]decane;hydrochloride is C1C2CC3CC1CC(C2)N3.Cl.
What is the InChIKey of 2-azatricyclo[3.3.1.13,7]decane;hydrochloride?
The InChIKey is ZWIULPRXCDAQFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N.ClH/c1-6-2-8-4-7(1)5-9(3-6)10-8;/h6-10H,1-5H2;1H.
What are the key properties of 2-azatricyclo[3.3.1.13,7]decane;hydrochloride?
2-azatricyclo[3.3.1.13,7]decane;hydrochloride has a molecular weight of 173.69 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azatricyclo[3.3.1.13,7]decane;hydrochloride is sourced from PubChem (CID 75529762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).