C15H26O6P2 — CID 75530029
butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid (PubChem CID 75530029) has the molecular formula C15H26O6P2 and a molecular weight of 364.32 g/mol. Its IUPAC name is butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid.
| Compound Name | butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid |
|---|---|
| PubChem CID | 75530029 |
| Molecular Formula | C15H26O6P2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid |
| SMILES | C#CCC(CC#C)(P(=O)(O)OC(C)CC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H26O6P2/c1-7-12-15(13-8-2,22(16,17)21-14(6)9-3)23(18,19-10-4)20-11-5/h1-2,14H,9-13H2,3-6H3,(H,16,17) |
| InChIKey | DQIMJAJWMSYHRJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|