About butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid
butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid (PubChem CID 75530029) has the molecular formula C15H26O6P2
and a molecular weight of 364.32 g/mol. Its IUPAC name is butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid.
Molecular Properties
| Compound Name | butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid |
| PubChem CID | 75530029 |
| Molecular Formula | C15H26O6P2 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid |
| SMILES | C#CCC(CC#C)(P(=O)(O)OC(C)CC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C15H26O6P2/c1-7-12-15(13-8-2,22(16,17)21-14(6)9-3)23(18,19-10-4)20-11-5/h1-2,14H,9-13H2,3-6H3,(H,16,17) |
| InChIKey | DQIMJAJWMSYHRJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid?
The IUPAC name of butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid (CID 75530029) is butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid.
What is the SMILES notation for butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid?
The canonical SMILES for butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid is C#CCC(CC#C)(P(=O)(O)OC(C)CC)P(=O)(OCC)OCC.
What is the InChIKey of butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid?
The InChIKey is DQIMJAJWMSYHRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O6P2/c1-7-12-15(13-8-2,22(16,17)21-14(6)9-3)23(18,19-10-4)20-11-5/h1-2,14H,9-13H2,3-6H3,(H,16,17).
What are the key properties of butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid?
butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid has a molecular weight of 364.32 g/mol, XLogP of 4.00, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yloxy(4-diethoxyphosphorylhepta-1,6-diyn-4-yl)phosphinic acid is sourced from PubChem (CID 75530029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).