methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid

C3H4F5O3P — CID 75530351

IUPACmethoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid
SMILESCOP(=O)(O)C(F)(F)C(F)(F)F
InChIInChI=1S/C3H4F5O3P/c1-11-12(9,10)3(7,8)2(4,5)6/h1H3,(H,9,10)
InChIKeySRLOXUMCZBPUIG-UHFFFAOYSA-N
MW214.03 g/mol
LogP1.97
Rot. Bonds2

About methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid

methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid (PubChem CID 75530351) has the molecular formula C3H4F5O3P and a molecular weight of 214.03 g/mol. Its IUPAC name is methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid.

Molecular Properties

Compound Namemethoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid
PubChem CID75530351
Molecular FormulaC3H4F5O3P
Molecular Weight214.03 g/mol
Exact Mass213.98
IUPAC Namemethoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid
SMILESCOP(=O)(O)C(F)(F)C(F)(F)F
InChIInChI=1S/C3H4F5O3P/c1-11-12(9,10)3(7,8)2(4,5)6/h1H3,(H,9,10)
InChIKeySRLOXUMCZBPUIG-UHFFFAOYSA-N
XLogP1.97
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.03
LogP ≤ 51.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid?
The IUPAC name of methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid (CID 75530351) is methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid.
What is the SMILES notation for methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid?
The canonical SMILES for methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid is COP(=O)(O)C(F)(F)C(F)(F)F.
What is the InChIKey of methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid?
The InChIKey is SRLOXUMCZBPUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4F5O3P/c1-11-12(9,10)3(7,8)2(4,5)6/h1H3,(H,9,10).
What are the key properties of methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid?
methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid has a molecular weight of 214.03 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy(1,1,2,2,2-pentafluoroethyl)phosphinic acid is sourced from PubChem (CID 75530351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).