C7H2F5N3 — CID 75530352
6-(1,1,2,2,2-pentafluoroethyl)pyrazine-2-carbonitrile (PubChem CID 75530352) has the molecular formula C7H2F5N3 and a molecular weight of 223.10 g/mol. Its IUPAC name is 6-(1,1,2,2,2-pentafluoroethyl)pyrazine-2-carbonitrile.
| Compound Name | 6-(1,1,2,2,2-pentafluoroethyl)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 75530352 |
| Molecular Formula | C7H2F5N3 |
| Molecular Weight | 223.10 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 6-(1,1,2,2,2-pentafluoroethyl)pyrazine-2-carbonitrile |
| SMILES | N#Cc1cncc(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C7H2F5N3/c8-6(9,7(10,11)12)5-3-14-2-4(1-13)15-5/h2-3H |
| InChIKey | KHLPZDVRVKMMQE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.10 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|