C8H12F5NS — CID 75530365
2-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)piperidine (PubChem CID 75530365) has the molecular formula C8H12F5NS and a molecular weight of 249.25 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)piperidine.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)piperidine |
|---|---|
| PubChem CID | 75530365 |
| Molecular Formula | C8H12F5NS |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)piperidine |
| SMILES | FC(F)(F)C(F)(F)SCC1CCCCN1 |
| InChI | InChI=1S/C8H12F5NS/c9-7(10,11)8(12,13)15-5-6-3-1-2-4-14-6/h6,14H,1-5H2 |
| InChIKey | UHLADUYZZJOEJJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|