C7H10F5NS — CID 75530366
(2S)-2-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)pyrrolidine (PubChem CID 75530366) has the molecular formula C7H10F5NS and a molecular weight of 235.22 g/mol. Its IUPAC name is (2S)-2-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)pyrrolidine.
| Compound Name | (2S)-2-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)pyrrolidine |
|---|---|
| PubChem CID | 75530366 |
| Molecular Formula | C7H10F5NS |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | (2S)-2-(1,1,2,2,2-pentafluoroethylsulfanylmethyl)pyrrolidine |
| SMILES | FC(F)(F)C(F)(F)SC[C@@H]1CCCN1 |
| InChI | InChI=1S/C7H10F5NS/c8-6(9,10)7(11,12)14-4-5-2-1-3-13-5/h5,13H,1-4H2/t5-/m0/s1 |
| InChIKey | AHLWNWSMOWSOBU-YFKPBYRVSA-N |
| XLogP | 2.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|