About 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate
2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate (PubChem CID 75530731) has the molecular formula C4H8N4O3
and a molecular weight of 160.13 g/mol. Its IUPAC name is 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate.
Molecular Properties
| Compound Name | 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate |
| PubChem CID | 75530731 |
| Molecular Formula | C4H8N4O3 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate |
| SMILES | Nc1n[nH]c(CC(=O)O)n1.O |
| InChI | InChI=1S/C4H6N4O2.H2O/c5-4-6-2(7-8-4)1-3(9)10;/h1H2,(H,9,10)(H3,5,6,7,8);1H2 |
| InChIKey | DVXATJGUAOUDJU-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate?
The IUPAC name of 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate (CID 75530731) is 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate.
What is the SMILES notation for 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate?
The canonical SMILES for 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate is Nc1n[nH]c(CC(=O)O)n1.O.
What is the InChIKey of 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate?
The InChIKey is DVXATJGUAOUDJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N4O2.H2O/c5-4-6-2(7-8-4)1-3(9)10;/h1H2,(H,9,10)(H3,5,6,7,8);1H2.
What are the key properties of 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate?
2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate has a molecular weight of 160.13 g/mol, XLogP of -1.81, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1H-1,2,4-triazol-5-yl)acetic acid;hydrate is sourced from PubChem (CID 75530731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).