About 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride
9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride (PubChem CID 75530777) has the molecular formula C8H18Cl2N2O
and a molecular weight of 229.15 g/mol. Its IUPAC name is 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride.
Molecular Properties
| Compound Name | 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride |
| PubChem CID | 75530777 |
| Molecular Formula | C8H18Cl2N2O |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride |
| SMILES | CN1CCOC2(CCNC2)C1.Cl.Cl |
| InChI | InChI=1S/C8H16N2O.2ClH/c1-10-4-5-11-8(7-10)2-3-9-6-8;;/h9H,2-7H2,1H3;2*1H |
| InChIKey | UHEKRNCLBHYXHI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride?
The IUPAC name of 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride (CID 75530777) is 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride.
What is the SMILES notation for 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride?
The canonical SMILES for 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride is CN1CCOC2(CCNC2)C1.Cl.Cl.
What is the InChIKey of 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride?
The InChIKey is UHEKRNCLBHYXHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.2ClH/c1-10-4-5-11-8(7-10)2-3-9-6-8;;/h9H,2-7H2,1H3;2*1H.
What are the key properties of 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride?
9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride has a molecular weight of 229.15 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-6-oxa-2,9-diazaspiro[4.5]decane;dihydrochloride is sourced from PubChem (CID 75530777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).