About [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride
[(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride (PubChem CID 75531028) has the molecular formula C7H16ClNO2
and a molecular weight of 181.66 g/mol. Its IUPAC name is [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride.
Molecular Properties
| Compound Name | [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride |
| PubChem CID | 75531028 |
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight | 181.66 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride |
| SMILES | Cl.OC[C@@H]1CNC[C@H](CO)C1 |
| InChI | InChI=1S/C7H15NO2.ClH/c9-4-6-1-7(5-10)3-8-2-6;/h6-10H,1-5H2;1H/t6-,7+; |
| InChIKey | OASRRWXKEIFOMR-UKMDXRBESA-N |
| XLogP | -0.38 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.66 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride?
The IUPAC name of [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride (CID 75531028) is [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride.
What is the SMILES notation for [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride?
The canonical SMILES for [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride is Cl.OC[C@@H]1CNC[C@H](CO)C1.
What is the InChIKey of [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride?
The InChIKey is OASRRWXKEIFOMR-UKMDXRBESA-N. The full InChI is InChI=1S/C7H15NO2.ClH/c9-4-6-1-7(5-10)3-8-2-6;/h6-10H,1-5H2;1H/t6-,7+;.
What are the key properties of [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride?
[(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride has a molecular weight of 181.66 g/mol, XLogP of -0.38, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-5-(hydroxymethyl)piperidin-3-yl]methanol;hydrochloride is sourced from PubChem (CID 75531028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).