About 1-methylpyrazole-3,4-diamine;dihydrochloride
1-methylpyrazole-3,4-diamine;dihydrochloride (PubChem CID 75531037) has the molecular formula C4H10Cl2N4
and a molecular weight of 185.06 g/mol. Its IUPAC name is 1-methylpyrazole-3,4-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 1-methylpyrazole-3,4-diamine;dihydrochloride |
| PubChem CID | 75531037 |
| Molecular Formula | C4H10Cl2N4 |
| Molecular Weight | 185.06 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 1-methylpyrazole-3,4-diamine;dihydrochloride |
| SMILES | Cl.Cl.Cn1cc(N)c(N)n1 |
| InChI | InChI=1S/C4H8N4.2ClH/c1-8-2-3(5)4(6)7-8;;/h2H,5H2,1H3,(H2,6,7);2*1H |
| InChIKey | VZQLCVRAKGSMQM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.06 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylpyrazole-3,4-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrazole-3,4-diamine;dihydrochloride?
The IUPAC name of 1-methylpyrazole-3,4-diamine;dihydrochloride (CID 75531037) is 1-methylpyrazole-3,4-diamine;dihydrochloride.
What is the SMILES notation for 1-methylpyrazole-3,4-diamine;dihydrochloride?
The canonical SMILES for 1-methylpyrazole-3,4-diamine;dihydrochloride is Cl.Cl.Cn1cc(N)c(N)n1.
What is the InChIKey of 1-methylpyrazole-3,4-diamine;dihydrochloride?
The InChIKey is VZQLCVRAKGSMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4.2ClH/c1-8-2-3(5)4(6)7-8;;/h2H,5H2,1H3,(H2,6,7);2*1H.
What are the key properties of 1-methylpyrazole-3,4-diamine;dihydrochloride?
1-methylpyrazole-3,4-diamine;dihydrochloride has a molecular weight of 185.06 g/mol, XLogP of 0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrazole-3,4-diamine;dihydrochloride is sourced from PubChem (CID 75531037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).