About 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride
2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride (PubChem CID 75531066) has the molecular formula C10H20Cl2N2O
and a molecular weight of 255.19 g/mol. Its IUPAC name is 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride.
Molecular Properties
| Compound Name | 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride |
| PubChem CID | 75531066 |
| Molecular Formula | C10H20Cl2N2O |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride |
| SMILES | CN1CC2(CCNCC2)CCC1=O.Cl.Cl |
| InChI | InChI=1S/C10H18N2O.2ClH/c1-12-8-10(3-2-9(12)13)4-6-11-7-5-10;;/h11H,2-8H2,1H3;2*1H |
| InChIKey | HANZHFGJMOXVRU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride?
The IUPAC name of 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride (CID 75531066) is 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride.
What is the SMILES notation for 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride?
The canonical SMILES for 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride is CN1CC2(CCNCC2)CCC1=O.Cl.Cl.
What is the InChIKey of 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride?
The InChIKey is HANZHFGJMOXVRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O.2ClH/c1-12-8-10(3-2-9(12)13)4-6-11-7-5-10;;/h11H,2-8H2,1H3;2*1H.
What are the key properties of 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride?
2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride has a molecular weight of 255.19 g/mol, XLogP of 1.45, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride is sourced from PubChem (CID 75531066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).