About 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride
2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride (PubChem CID 75531158) has the molecular formula C5H10ClN3O
and a molecular weight of 163.61 g/mol. Its IUPAC name is 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride.
Molecular Properties
| Compound Name | 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride |
| PubChem CID | 75531158 |
| Molecular Formula | C5H10ClN3O |
| Molecular Weight | 163.61 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride |
| SMILES | Cl.O=C1NCC2(CNC2)N1 |
| InChI | InChI=1S/C5H9N3O.ClH/c9-4-7-3-5(8-4)1-6-2-5;/h6H,1-3H2,(H2,7,8,9);1H |
| InChIKey | HVJUIAJESRNOJG-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.61 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride?
The IUPAC name of 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride (CID 75531158) is 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride.
What is the SMILES notation for 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride?
The canonical SMILES for 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride is Cl.O=C1NCC2(CNC2)N1.
What is the InChIKey of 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride?
The InChIKey is HVJUIAJESRNOJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O.ClH/c9-4-7-3-5(8-4)1-6-2-5;/h6H,1-3H2,(H2,7,8,9);1H.
What are the key properties of 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride?
2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride has a molecular weight of 163.61 g/mol, XLogP of -0.94, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride is sourced from PubChem (CID 75531158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).