About 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride
4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride (PubChem CID 75531160) has the molecular formula C9H17ClN2O2
and a molecular weight of 220.70 g/mol. Its IUPAC name is 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride.
Molecular Properties
| Compound Name | 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride |
| PubChem CID | 75531160 |
| Molecular Formula | C9H17ClN2O2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride |
| SMILES | CN1CC2(CCNCC2)OCC1=O.Cl |
| InChI | InChI=1S/C9H16N2O2.ClH/c1-11-7-9(13-6-8(11)12)2-4-10-5-3-9;/h10H,2-7H2,1H3;1H |
| InChIKey | HGVHHEHOFFTUAE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride?
The IUPAC name of 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride (CID 75531160) is 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride.
What is the SMILES notation for 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride?
The canonical SMILES for 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride is CN1CC2(CCNCC2)OCC1=O.Cl.
What is the InChIKey of 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride?
The InChIKey is HGVHHEHOFFTUAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2.ClH/c1-11-7-9(13-6-8(11)12)2-4-10-5-3-9;/h10H,2-7H2,1H3;1H.
What are the key properties of 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride?
4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride has a molecular weight of 220.70 g/mol, XLogP of 0.02, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;hydrochloride is sourced from PubChem (CID 75531160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).