About 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride
5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride (PubChem CID 75531181) has the molecular formula C6H12ClN3O
and a molecular weight of 177.63 g/mol. Its IUPAC name is 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride.
Molecular Properties
| Compound Name | 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride |
| PubChem CID | 75531181 |
| Molecular Formula | C6H12ClN3O |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride |
| SMILES | CN1C(=O)NCC12CNC2.Cl |
| InChI | InChI=1S/C6H11N3O.ClH/c1-9-5(10)8-4-6(9)2-7-3-6;/h7H,2-4H2,1H3,(H,8,10);1H |
| InChIKey | PAURWMGHQVDYFG-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride?
The IUPAC name of 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride (CID 75531181) is 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride.
What is the SMILES notation for 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride?
The canonical SMILES for 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride is CN1C(=O)NCC12CNC2.Cl.
What is the InChIKey of 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride?
The InChIKey is PAURWMGHQVDYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O.ClH/c1-9-5(10)8-4-6(9)2-7-3-6;/h7H,2-4H2,1H3,(H,8,10);1H.
What are the key properties of 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride?
5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride has a molecular weight of 177.63 g/mol, XLogP of -0.59, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,5,7-triazaspiro[3.4]octan-6-one;hydrochloride is sourced from PubChem (CID 75531181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).