About 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride
4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride (PubChem CID 75531205) has the molecular formula C8H18Cl2N4O
and a molecular weight of 257.16 g/mol. Its IUPAC name is 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride.
Molecular Properties
| Compound Name | 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride |
| PubChem CID | 75531205 |
| Molecular Formula | C8H18Cl2N4O |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride |
| SMILES | Cl.Cl.Cn1cnnc1C1CCNCC1.O |
| InChI | InChI=1S/C8H14N4.2ClH.H2O/c1-12-6-10-11-8(12)7-2-4-9-5-3-7;;;/h6-7,9H,2-5H2,1H3;2*1H;1H2 |
| InChIKey | FYRSTVVNTSXARI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride?
The IUPAC name of 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride (CID 75531205) is 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride.
What is the SMILES notation for 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride?
The canonical SMILES for 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride is Cl.Cl.Cn1cnnc1C1CCNCC1.O.
What is the InChIKey of 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride?
The InChIKey is FYRSTVVNTSXARI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4.2ClH.H2O/c1-12-6-10-11-8(12)7-2-4-9-5-3-7;;;/h6-7,9H,2-5H2,1H3;2*1H;1H2.
What are the key properties of 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride?
4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride has a molecular weight of 257.16 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-1,2,4-triazol-3-yl)piperidine;hydrate;dihydrochloride is sourced from PubChem (CID 75531205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).