C15H19BrN2O — CID 75531303
2-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)ethanamine;hydrobromide (PubChem CID 75531303) has the molecular formula C15H19BrN2O and a molecular weight of 323.23 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)ethanamine;hydrobromide.
| Compound Name | 2-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)ethanamine;hydrobromide |
|---|---|
| PubChem CID | 75531303 |
| Molecular Formula | C15H19BrN2O |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-(pyridin-3-ylmethyl)ethanamine;hydrobromide |
| SMILES | Br.COc1ccc(CCNCc2cccnc2)cc1 |
| InChI | InChI=1S/C15H18N2O.BrH/c1-18-15-6-4-13(5-7-15)8-10-17-12-14-3-2-9-16-11-14;/h2-7,9,11,17H,8,10,12H2,1H3;1H |
| InChIKey | PHRPGDDRWFNRQT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|