C12H20ClNO — CID 75531600
2-(2,3-dimethylphenoxy)-N-ethylethanamine;hydrochloride (PubChem CID 75531600) has the molecular formula C12H20ClNO and a molecular weight of 229.75 g/mol. Its IUPAC name is 2-(2,3-dimethylphenoxy)-N-ethylethanamine;hydrochloride.
| Compound Name | 2-(2,3-dimethylphenoxy)-N-ethylethanamine;hydrochloride |
|---|---|
| PubChem CID | 75531600 |
| Molecular Formula | C12H20ClNO |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-(2,3-dimethylphenoxy)-N-ethylethanamine;hydrochloride |
| SMILES | CCNCCOc1cccc(C)c1C.Cl |
| InChI | InChI=1S/C12H19NO.ClH/c1-4-13-8-9-14-12-7-5-6-10(2)11(12)3;/h5-7,13H,4,8-9H2,1-3H3;1H |
| InChIKey | MNPLMDZUBJAPHG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|