6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid

C5H6N4O2S — CID 75532036

IUPAC6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid
SMILESO=C(O)C1CCn2nnnc2S1
InChIInChI=1S/C5H6N4O2S/c10-4(11)3-1-2-9-5(12-3)6-7-8-9/h3H,1-2H2,(H,10,11)
InChIKeySRPMNMVUALHIFD-UHFFFAOYSA-N
MW186.20 g/mol
LogP-0.38
Rot. Bonds1

About 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid

6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid (PubChem CID 75532036) has the molecular formula C5H6N4O2S and a molecular weight of 186.20 g/mol. Its IUPAC name is 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid.

Molecular Properties

Compound Name6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid
PubChem CID75532036
Molecular FormulaC5H6N4O2S
Molecular Weight186.20 g/mol
Exact Mass186.02
IUPAC Name6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid
SMILESO=C(O)C1CCn2nnnc2S1
InChIInChI=1S/C5H6N4O2S/c10-4(11)3-1-2-9-5(12-3)6-7-8-9/h3H,1-2H2,(H,10,11)
InChIKeySRPMNMVUALHIFD-UHFFFAOYSA-N
XLogP-0.38
TPSA80.90 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.20
LogP ≤ 5-0.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid?
The IUPAC name of 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid (CID 75532036) is 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid.
What is the SMILES notation for 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid?
The canonical SMILES for 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid is O=C(O)C1CCn2nnnc2S1.
What is the InChIKey of 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid?
The InChIKey is SRPMNMVUALHIFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O2S/c10-4(11)3-1-2-9-5(12-3)6-7-8-9/h3H,1-2H2,(H,10,11).
What are the key properties of 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid?
6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid has a molecular weight of 186.20 g/mol, XLogP of -0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-tetrazolo[5,1-b][1,3]thiazine-5-carboxylic acid is sourced from PubChem (CID 75532036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).