2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid

C10H15NO3 — CID 75532043

IUPAC2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid
SMILESCc1nc(C(C)(C)C)oc1CC(=O)O
InChIInChI=1S/C10H15NO3/c1-6-7(5-8(12)13)14-9(11-6)10(2,3)4/h5H2,1-4H3,(H,12,13)
InChIKeyRWNMSMUWOYFMPW-UHFFFAOYSA-N
MW197.23 g/mol
LogP1.91
Rot. Bonds2

About 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid

2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid (PubChem CID 75532043) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid
PubChem CID75532043
Molecular FormulaC10H15NO3
Molecular Weight197.23 g/mol
Exact Mass197.11
IUPAC Name2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid
SMILESCc1nc(C(C)(C)C)oc1CC(=O)O
InChIInChI=1S/C10H15NO3/c1-6-7(5-8(12)13)14-9(11-6)10(2,3)4/h5H2,1-4H3,(H,12,13)
InChIKeyRWNMSMUWOYFMPW-UHFFFAOYSA-N
XLogP1.91
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.23
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid?
The IUPAC name of 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid (CID 75532043) is 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid.
What is the SMILES notation for 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid?
The canonical SMILES for 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid is Cc1nc(C(C)(C)C)oc1CC(=O)O.
What is the InChIKey of 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid?
The InChIKey is RWNMSMUWOYFMPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-6-7(5-8(12)13)14-9(11-6)10(2,3)4/h5H2,1-4H3,(H,12,13).
What are the key properties of 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid?
2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid has a molecular weight of 197.23 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-tert-butyl-4-methyl-1,3-oxazol-5-yl)acetic acid is sourced from PubChem (CID 75532043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).