C11H23IN4O2 — CID 75532537
N-[2-[[N-cyclopropyl-N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide (PubChem CID 75532537) has the molecular formula C11H23IN4O2 and a molecular weight of 370.24 g/mol. Its IUPAC name is N-[2-[[N-cyclopropyl-N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide.
| Compound Name | N-[2-[[N-cyclopropyl-N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 75532537 |
| Molecular Formula | C11H23IN4O2 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-[2-[[N-cyclopropyl-N'-(2-methoxyethyl)carbamimidoyl]amino]ethyl]acetamide;hydroiodide |
| SMILES | COCC/N=C(\NCCNC(C)=O)NC1CC1.I |
| InChI | InChI=1S/C11H22N4O2.HI/c1-9(16)12-5-6-13-11(14-7-8-17-2)15-10-3-4-10;/h10H,3-8H2,1-2H3,(H,12,16)(H2,13,14,15);1H |
| InChIKey | WKQCVBCEVYLMQE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|